C19H22N4O3 — CID 59891745
N-[3-hydroxy-4-[[4-(methylideneamino)phenyl]carbamoylamino]phenyl]-2-methylbutanamide (PubChem CID 59891745) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[3-hydroxy-4-[[4-(methylideneamino)phenyl]carbamoylamino]phenyl]-2-methylbutanamide.
| Compound Name | N-[3-hydroxy-4-[[4-(methylideneamino)phenyl]carbamoylamino]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 59891745 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[3-hydroxy-4-[[4-(methylideneamino)phenyl]carbamoylamino]phenyl]-2-methylbutanamide |
| SMILES | C=Nc1ccc(NC(=O)Nc2ccc(NC(=O)C(C)CC)cc2O)cc1 |
| InChI | InChI=1S/C19H22N4O3/c1-4-12(2)18(25)21-15-9-10-16(17(24)11-15)23-19(26)22-14-7-5-13(20-3)6-8-14/h5-12,24H,3-4H2,1-2H3,(H,21,25)(H2,22,23,26) |
| InChIKey | KITXRRSGHPEYOU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|