C24H25F3N2OS — CID 59891817
3-[(S)-[(2S,5R)-2,5-dimethyl-4-[(3,4,5-trifluorophenyl)methyl]piperazin-1-yl]-thiophen-3-ylmethyl]phenol (PubChem CID 59891817) has the molecular formula C24H25F3N2OS and a molecular weight of 446.54 g/mol. Its IUPAC name is 3-[(S)-[(2S,5R)-2,5-dimethyl-4-[(3,4,5-trifluorophenyl)methyl]piperazin-1-yl]-thiophen-3-ylmethyl]phenol.
| Compound Name | 3-[(S)-[(2S,5R)-2,5-dimethyl-4-[(3,4,5-trifluorophenyl)methyl]piperazin-1-yl]-thiophen-3-ylmethyl]phenol |
|---|---|
| PubChem CID | 59891817 |
| Molecular Formula | C24H25F3N2OS |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 3-[(S)-[(2S,5R)-2,5-dimethyl-4-[(3,4,5-trifluorophenyl)methyl]piperazin-1-yl]-thiophen-3-ylmethyl]phenol |
| SMILES | C[C@@H]1CN([C@H](c2ccsc2)c2cccc(O)c2)[C@@H](C)CN1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C24H25F3N2OS/c1-15-12-29(24(19-6-7-31-14-19)18-4-3-5-20(30)10-18)16(2)11-28(15)13-17-8-21(25)23(27)22(26)9-17/h3-10,14-16,24,30H,11-13H2,1-2H3/t15-,16+,24+/m1/s1 |
| InChIKey | VQCAQABOKAPGFU-YPCHGGDPSA-N |
| XLogP | 5.56 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|