C10H20O3 — CID 59891825
(2S,3S,4R,5S)-2,4,6-trimethylhept-6-ene-1,3,5-triol (PubChem CID 59891825) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2,4,6-trimethylhept-6-ene-1,3,5-triol.
| Compound Name | (2S,3S,4R,5S)-2,4,6-trimethylhept-6-ene-1,3,5-triol |
|---|---|
| PubChem CID | 59891825 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (2S,3S,4R,5S)-2,4,6-trimethylhept-6-ene-1,3,5-triol |
| SMILES | C=C(C)[C@@H](O)[C@H](C)[C@@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C10H20O3/c1-6(2)9(12)8(4)10(13)7(3)5-11/h7-13H,1,5H2,2-4H3/t7-,8-,9+,10-/m0/s1 |
| InChIKey | RFORXBKAOTTXCY-QEYWKRMJSA-N |
| XLogP | 0.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|