About CID 59891948
CID 59891948 (PubChem CID 59891948) has the molecular formula C14H27O4Si
and a molecular weight of 287.45 g/mol.
Molecular Properties
| Compound Name | CID 59891948 |
| PubChem CID | 59891948 |
| Molecular Formula | C14H27O4Si |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | — |
| SMILES | C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O[C@H]1[CH]O |
| InChI | InChI=1S/C14H27O4Si/c1-9-11(8-15)17-13(16)10(2)12(9)18-19(6,7)14(3,4)5/h8-12,15H,1-7H3/t9-,10+,11-,12-/m0/s1 |
| InChIKey | DLJXOPNLRORHBS-USZNOCQGSA-N |
| XLogP | 3.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59891948 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59891948?
The IUPAC name of CID 59891948 (CID 59891948) is not available.
What is the SMILES notation for CID 59891948?
The canonical SMILES for CID 59891948 is C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O[C@H]1[CH]O.
What is the InChIKey of CID 59891948?
The InChIKey is DLJXOPNLRORHBS-USZNOCQGSA-N. The full InChI is InChI=1S/C14H27O4Si/c1-9-11(8-15)17-13(16)10(2)12(9)18-19(6,7)14(3,4)5/h8-12,15H,1-7H3/t9-,10+,11-,12-/m0/s1.
What are the key properties of CID 59891948?
CID 59891948 has a molecular weight of 287.45 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59891948 is sourced from PubChem (CID 59891948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).