C34H28F2N3O3PS — CID 59892059
[[4-[2-(benzotriazol-1-yl)-2-[4-(4-methylsulfanylphenyl)phenyl]-2-phenylethyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 59892059) has the molecular formula C34H28F2N3O3PS and a molecular weight of 627.65 g/mol. Its IUPAC name is [[4-[2-(benzotriazol-1-yl)-2-[4-(4-methylsulfanylphenyl)phenyl]-2-phenylethyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[2-(benzotriazol-1-yl)-2-[4-(4-methylsulfanylphenyl)phenyl]-2-phenylethyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 59892059 |
| Molecular Formula | C34H28F2N3O3PS |
| Molecular Weight | 627.65 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | [[4-[2-(benzotriazol-1-yl)-2-[4-(4-methylsulfanylphenyl)phenyl]-2-phenylethyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | CSc1ccc(-c2ccc(C(Cc3ccc(C(F)(F)P(=O)(O)O)cc3)(c3ccccc3)n3nnc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C34H28F2N3O3PS/c1-44-30-21-15-26(16-22-30)25-13-19-28(20-14-25)33(27-7-3-2-4-8-27,39-32-10-6-5-9-31(32)37-38-39)23-24-11-17-29(18-12-24)34(35,36)43(40,41)42/h2-22H,23H2,1H3,(H2,40,41,42) |
| InChIKey | XHOCRRKGUPSWMC-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.65 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|