C13H27O7S- — CID 59892870
3,5-bis(2-methoxypropoxy)pentane-1-sulfonate (PubChem CID 59892870) has the molecular formula C13H27O7S- and a molecular weight of 327.42 g/mol. Its IUPAC name is 3,5-bis(2-methoxypropoxy)pentane-1-sulfonate.
| Compound Name | 3,5-bis(2-methoxypropoxy)pentane-1-sulfonate |
|---|---|
| PubChem CID | 59892870 |
| Molecular Formula | C13H27O7S- |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3,5-bis(2-methoxypropoxy)pentane-1-sulfonate |
| SMILES | COC(C)COCCC(CCS(=O)(=O)[O-])OCC(C)OC |
| InChI | InChI=1S/C13H28O7S/c1-11(17-3)9-19-7-5-13(6-8-21(14,15)16)20-10-12(2)18-4/h11-13H,5-10H2,1-4H3,(H,14,15,16)/p-1 |
| InChIKey | NJRZKYFLBKHBLE-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|