About 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten
1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten (PubChem CID 59892903) has the molecular formula C9H12NW-
and a molecular weight of 318.04 g/mol. Its IUPAC name is 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten.
Molecular Properties
| Compound Name | 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten |
| PubChem CID | 59892903 |
| Molecular Formula | C9H12NW- |
| Molecular Weight | 318.04 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten |
| SMILES | C=C1C(C)=CC(C)=[C-]N1C.[W] |
| InChI | InChI=1S/C9H12N.W/c1-7-5-8(2)9(3)10(4)6-7;/h5H,3H2,1-2,4H3;/q-1; |
| InChIKey | WUKOYIRLWAHORQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.04 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten?
The IUPAC name of 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten (CID 59892903) is 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten.
What is the SMILES notation for 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten?
The canonical SMILES for 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten is C=C1C(C)=CC(C)=[C-]N1C.[W].
What is the InChIKey of 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten?
The InChIKey is WUKOYIRLWAHORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.W/c1-7-5-8(2)9(3)10(4)6-7;/h5H,3H2,1-2,4H3;/q-1;.
What are the key properties of 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten?
1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten has a molecular weight of 318.04 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trimethyl-6-methylidene-2H-pyridin-2-ide;tungsten is sourced from PubChem (CID 59892903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).