C15H30N3O3P — CID 59892952
ethyl N-bis(2,2,3,3-tetramethylaziridin-1-yl)phosphorylcarbamate (PubChem CID 59892952) has the molecular formula C15H30N3O3P and a molecular weight of 331.40 g/mol. Its IUPAC name is ethyl N-bis(2,2,3,3-tetramethylaziridin-1-yl)phosphorylcarbamate.
| Compound Name | ethyl N-bis(2,2,3,3-tetramethylaziridin-1-yl)phosphorylcarbamate |
|---|---|
| PubChem CID | 59892952 |
| Molecular Formula | C15H30N3O3P |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | ethyl N-bis(2,2,3,3-tetramethylaziridin-1-yl)phosphorylcarbamate |
| SMILES | CCOC(=O)NP(=O)(N1C(C)(C)C1(C)C)N1C(C)(C)C1(C)C |
| InChI | InChI=1S/C15H30N3O3P/c1-10-21-11(19)16-22(20,17-12(2,3)13(17,4)5)18-14(6,7)15(18,8)9/h10H2,1-9H3,(H,16,19,20) |
| InChIKey | BSLSFZAZVQFZIW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|