C28H36F6O6 — CID 59893059
methyl 5-[4-[2,3-dimethyl-6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]-6,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59893059) has the molecular formula C28H36F6O6 and a molecular weight of 582.58 g/mol. Its IUPAC name is methyl 5-[4-[2,3-dimethyl-6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]-6,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl 5-[4-[2,3-dimethyl-6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]-6,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59893059 |
| Molecular Formula | C28H36F6O6 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | methyl 5-[4-[2,3-dimethyl-6-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]-6,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)C1CC2CC1C(C)(C)C2C1C(=O)OC(=O)C1C1(C)C(C)C2CC(CC(O)(C(F)(F)F)C(F)(F)F)C1C2 |
| InChI | InChI=1S/C28H36F6O6/c1-11-12-6-14(10-26(38,27(29,30)31)28(32,33)34)16(8-12)25(11,4)20-18(22(36)40-23(20)37)19-13-7-15(21(35)39-5)17(9-13)24(19,2)3/h11-20,38H,6-10H2,1-5H3 |
| InChIKey | YIQNMPCCSFZQPK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|