C22H20Cl2IN3O6S2 — CID 59893209
[(2Z)-2-[(2E)-2-[[1-(carboxymethyl)-5-iodothieno[3,2-d][1,3]oxazol-1-ium-2-yl]methylidene]butylidene]-5,6-dichloro-3-ethylbenzimidazol-1-yl]methanesulfonate (PubChem CID 59893209) has the molecular formula C22H20Cl2IN3O6S2 and a molecular weight of 684.36 g/mol. Its IUPAC name is [(2Z)-2-[(2E)-2-[[1-(carboxymethyl)-5-iodothieno[3,2-d][1,3]oxazol-1-ium-2-yl]methylidene]butylidene]-5,6-dichloro-3-ethylbenzimidazol-1-yl]methanesulfonate.
| Compound Name | [(2Z)-2-[(2E)-2-[[1-(carboxymethyl)-5-iodothieno[3,2-d][1,3]oxazol-1-ium-2-yl]methylidene]butylidene]-5,6-dichloro-3-ethylbenzimidazol-1-yl]methanesulfonate |
|---|---|
| PubChem CID | 59893209 |
| Molecular Formula | C22H20Cl2IN3O6S2 |
| Molecular Weight | 684.36 g/mol |
| Exact Mass | 682.92 |
| IUPAC Name | [(2Z)-2-[(2E)-2-[[1-(carboxymethyl)-5-iodothieno[3,2-d][1,3]oxazol-1-ium-2-yl]methylidene]butylidene]-5,6-dichloro-3-ethylbenzimidazol-1-yl]methanesulfonate |
| SMILES | CCC(/C=C1/N(CC)c2cc(Cl)c(Cl)cc2N1CS(=O)(=O)[O-])=C\c1oc2sc(I)cc2[n+]1CC(=O)O |
| InChI | InChI=1S/C22H20Cl2IN3O6S2/c1-3-12(6-20-27(10-21(29)30)17-9-18(25)35-22(17)34-20)5-19-26(4-2)15-7-13(23)14(24)8-16(15)28(19)11-36(31,32)33/h5-9H,3-4,10-11H2,1-2H3,(H-,29,30,31,32,33) |
| InChIKey | HLECZEMIXRSCBK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|