C19H20N5O7S3- — CID 59893269
[(2E)-2-[(2Z)-2-[3-[2-(2-hydroxyethoxy)ethyl]-1-(5-methyl-1H-pyrazol-3-yl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]thieno[2,3-d][1,3]oxazol-3-yl]methanesulfonate (PubChem CID 59893269) has the molecular formula C19H20N5O7S3- and a molecular weight of 526.60 g/mol. Its IUPAC name is [(2E)-2-[(2Z)-2-[3-[2-(2-hydroxyethoxy)ethyl]-1-(5-methyl-1H-pyrazol-3-yl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]thieno[2,3-d][1,3]oxazol-3-yl]methanesulfonate.
| Compound Name | [(2E)-2-[(2Z)-2-[3-[2-(2-hydroxyethoxy)ethyl]-1-(5-methyl-1H-pyrazol-3-yl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]thieno[2,3-d][1,3]oxazol-3-yl]methanesulfonate |
|---|---|
| PubChem CID | 59893269 |
| Molecular Formula | C19H20N5O7S3- |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | [(2E)-2-[(2Z)-2-[3-[2-(2-hydroxyethoxy)ethyl]-1-(5-methyl-1H-pyrazol-3-yl)-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]ethylidene]thieno[2,3-d][1,3]oxazol-3-yl]methanesulfonate |
| SMILES | Cc1cc(N2C(=O)/C(=C/C=C3/Oc4ccsc4N3CS(=O)(=O)[O-])N(CCOCCO)C2=S)n[nH]1 |
| InChI | InChI=1S/C19H21N5O7S3/c1-12-10-15(21-20-12)24-17(26)13(22(19(24)32)5-7-30-8-6-25)2-3-16-23(11-34(27,28)29)18-14(31-16)4-9-33-18/h2-4,9-10,25H,5-8,11H2,1H3,(H,20,21)(H,27,28,29)/p-1/b13-2-,16-3+ |
| InChIKey | ZNSLQJRSYYFXBI-IBYVKKCRSA-M |
| XLogP | 0.85 |
| TPSA | 151.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|