C18H15ClN2O6S3 — CID 59893279
[2-[[3-(carboxymethyl)-5-chloro-1,3-benzothiazol-2-ylidene]methyl]-5,6-dimethylthieno[3,2-d][1,3]oxazol-1-ium-1-yl]methanesulfonate (PubChem CID 59893279) has the molecular formula C18H15ClN2O6S3 and a molecular weight of 486.98 g/mol. Its IUPAC name is [2-[[3-(carboxymethyl)-5-chloro-1,3-benzothiazol-2-ylidene]methyl]-5,6-dimethylthieno[3,2-d][1,3]oxazol-1-ium-1-yl]methanesulfonate.
| Compound Name | [2-[[3-(carboxymethyl)-5-chloro-1,3-benzothiazol-2-ylidene]methyl]-5,6-dimethylthieno[3,2-d][1,3]oxazol-1-ium-1-yl]methanesulfonate |
|---|---|
| PubChem CID | 59893279 |
| Molecular Formula | C18H15ClN2O6S3 |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | [2-[[3-(carboxymethyl)-5-chloro-1,3-benzothiazol-2-ylidene]methyl]-5,6-dimethylthieno[3,2-d][1,3]oxazol-1-ium-1-yl]methanesulfonate |
| SMILES | Cc1sc2oc(C=C3Sc4ccc(Cl)cc4N3CC(=O)O)[n+](CS(=O)(=O)[O-])c2c1C |
| InChI | InChI=1S/C18H15ClN2O6S3/c1-9-10(2)28-18-17(9)21(8-30(24,25)26)14(27-18)6-15-20(7-16(22)23)12-5-11(19)3-4-13(12)29-15/h3-6H,7-8H2,1-2H3,(H-,22,23,24,25,26) |
| InChIKey | DUSHSCGPUHPGOL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|