C18H16Cl3N2O8S3+ — CID 59893292
3-[5-chloro-2-[[4,6-dichloro-3-(sulfomethyl)furo[3,4-d][1,3]thiazol-3-ium-2-yl]methylidene]-6-methyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid (PubChem CID 59893292) has the molecular formula C18H16Cl3N2O8S3+ and a molecular weight of 590.89 g/mol. Its IUPAC name is 3-[5-chloro-2-[[4,6-dichloro-3-(sulfomethyl)furo[3,4-d][1,3]thiazol-3-ium-2-yl]methylidene]-6-methyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-chloro-2-[[4,6-dichloro-3-(sulfomethyl)furo[3,4-d][1,3]thiazol-3-ium-2-yl]methylidene]-6-methyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59893292 |
| Molecular Formula | C18H16Cl3N2O8S3+ |
| Molecular Weight | 590.89 g/mol |
| Exact Mass | 588.91 |
| IUPAC Name | 3-[5-chloro-2-[[4,6-dichloro-3-(sulfomethyl)furo[3,4-d][1,3]thiazol-3-ium-2-yl]methylidene]-6-methyl-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
| SMILES | Cc1cc2c(cc1Cl)N(CCCS(=O)(=O)O)C(=Cc1sc3c(Cl)oc(Cl)c3[n+]1CS(=O)(=O)O)O2 |
| InChI | InChI=1S/C18H15Cl3N2O8S3/c1-9-5-12-11(6-10(9)19)22(3-2-4-33(24,25)26)13(30-12)7-14-23(8-34(27,28)29)15-16(32-14)18(21)31-17(15)20/h5-7H,2-4,8H2,1H3,(H-,24,25,26,27,28,29)/p+1 |
| InChIKey | HDJIIZVJWBPYGB-UHFFFAOYSA-O |
| XLogP | 4.37 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.89 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|