C16H14FN2O8S3+ — CID 59893296
[2-[[5-fluoro-3-(sulfomethyl)thieno[2,3-d][1,3]oxazol-3-ium-2-yl]methylidene]-5-methyl-1,3-benzoxazol-3-yl]methanesulfonic acid (PubChem CID 59893296) has the molecular formula C16H14FN2O8S3+ and a molecular weight of 477.49 g/mol. Its IUPAC name is [2-[[5-fluoro-3-(sulfomethyl)thieno[2,3-d][1,3]oxazol-3-ium-2-yl]methylidene]-5-methyl-1,3-benzoxazol-3-yl]methanesulfonic acid.
| Compound Name | [2-[[5-fluoro-3-(sulfomethyl)thieno[2,3-d][1,3]oxazol-3-ium-2-yl]methylidene]-5-methyl-1,3-benzoxazol-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 59893296 |
| Molecular Formula | C16H14FN2O8S3+ |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | [2-[[5-fluoro-3-(sulfomethyl)thieno[2,3-d][1,3]oxazol-3-ium-2-yl]methylidene]-5-methyl-1,3-benzoxazol-3-yl]methanesulfonic acid |
| SMILES | Cc1ccc2c(c1)N(CS(=O)(=O)O)C(=Cc1oc3cc(F)sc3[n+]1CS(=O)(=O)O)O2 |
| InChI | InChI=1S/C16H13FN2O8S3/c1-9-2-3-11-10(4-9)18(7-29(20,21)22)14(26-11)6-15-19(8-30(23,24)25)16-12(27-15)5-13(17)28-16/h2-6H,7-8H2,1H3,(H-,20,21,22,23,24,25)/p+1 |
| InChIKey | SRRMRMXKTSBIRJ-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|