About 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one
4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one (PubChem CID 59893655) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one.
Molecular Properties
| Compound Name | 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one |
| PubChem CID | 59893655 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one |
| SMILES | CCC1CC(CC)C(CCC2COC(=O)C2)C1 |
| InChI | InChI=1S/C15H26O2/c1-3-11-7-13(4-2)14(8-11)6-5-12-9-15(16)17-10-12/h11-14H,3-10H2,1-2H3 |
| InChIKey | XJGGMJXWHHJFFZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one?
The IUPAC name of 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one (CID 59893655) is 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one.
What is the SMILES notation for 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one?
The canonical SMILES for 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one is CCC1CC(CC)C(CCC2COC(=O)C2)C1.
What is the InChIKey of 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one?
The InChIKey is XJGGMJXWHHJFFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-3-11-7-13(4-2)14(8-11)6-5-12-9-15(16)17-10-12/h11-14H,3-10H2,1-2H3.
What are the key properties of 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one?
4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one has a molecular weight of 238.37 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-diethylcyclopentyl)ethyl]oxolan-2-one is sourced from PubChem (CID 59893655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).