C60H89N15O16S — CID 59893900
CID 59893900 (PubChem CID 59893900) has the molecular formula C60H89N15O16S and a molecular weight of 1308.53 g/mol.
| Compound Name | CID 59893900 |
|---|---|
| PubChem CID | 59893900 |
| Molecular Formula | C60H89N15O16S |
| Molecular Weight | 1308.53 g/mol |
| Exact Mass | 1307.63 |
| IUPAC Name | — |
| SMILES | [CH]N1CCN(CC(=O)O)CCN(CC(O)O)CCN(CC(=O)NC(CCC(=O)NCCCOCCCNC(=O)CCC(=O)NCCCn2cc(C(=O)NCC(NS(=O)(=O)c3c(C)cc(C)cc3C)C(=O)O)c(=O)c3ccc(CNc4ncc[nH]4)cc32)C(=O)NC)CC1 |
| InChI | InChI=1S/C60H89N15O16S/c1-40-31-41(2)56(42(3)32-40)92(89,90)70-47(59(87)88)35-67-57(85)45-36-75(48-33-43(9-10-44(48)55(45)84)34-68-60-65-18-19-66-60)20-6-15-62-50(77)13-14-51(78)64-17-8-30-91-29-7-16-63-49(76)12-11-46(58(86)61-4)69-52(79)37-72-23-21-71(5)22-24-73(38-53(80)81)27-28-74(26-25-72)39-54(82)83/h5,9-10,18-19,31-33,36,46-47,54,70,82-83H,6-8,11-17,20-30,34-35,37-39H2,1-4H3,(H,61,86)(H,62,77)(H,63,76)(H,64,78)(H,67,85)(H,69,79)(H,80,81)(H,87,88)(H2,65,66,68) |
| InChIKey | ZYQBWYZBRHKSRZ-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 420.73 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1308.53 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|