C11H21NO — CID 59893985
(4R)-2,4-ditert-butyl-4,5-dihydro-1,3-oxazole (PubChem CID 59893985) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (4R)-2,4-ditert-butyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-2,4-ditert-butyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 59893985 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (4R)-2,4-ditert-butyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C)C1=N[C@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C11H21NO/c1-10(2,3)8-7-13-9(12-8)11(4,5)6/h8H,7H2,1-6H3/t8-/m0/s1 |
| InChIKey | PTIVBLUCOGTHCE-QMMMGPOBSA-N |
| XLogP | 2.88 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |