C18H22N2O2 — CID 59894364
3-[(2R,3aS,6aS)-6a-(methylperoxymethyl)-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrol-2-yl]quinoline (PubChem CID 59894364) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 3-[(2R,3aS,6aS)-6a-(methylperoxymethyl)-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrol-2-yl]quinoline.
| Compound Name | 3-[(2R,3aS,6aS)-6a-(methylperoxymethyl)-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrol-2-yl]quinoline |
|---|---|
| PubChem CID | 59894364 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-[(2R,3aS,6aS)-6a-(methylperoxymethyl)-2,3,3a,4,5,6-hexahydro-1H-cyclopenta[b]pyrrol-2-yl]quinoline |
| SMILES | COOC[C@]12CCC[C@H]1C[C@H](c1cnc3ccccc3c1)N2 |
| InChI | InChI=1S/C18H22N2O2/c1-21-22-12-18-8-4-6-15(18)10-17(20-18)14-9-13-5-2-3-7-16(13)19-11-14/h2-3,5,7,9,11,15,17,20H,4,6,8,10,12H2,1H3/t15-,17+,18+/m0/s1 |
| InChIKey | QGUYMBURJWZVOU-CGTJXYLNSA-N |
| XLogP | 3.39 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|