C16H19NO5 — CID 59894554
(6S)-6-(3,4-dimethoxyphenyl)-8-methyl-6,7,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridine-3,5-dione (PubChem CID 59894554) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is (6S)-6-(3,4-dimethoxyphenyl)-8-methyl-6,7,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridine-3,5-dione.
| Compound Name | (6S)-6-(3,4-dimethoxyphenyl)-8-methyl-6,7,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridine-3,5-dione |
|---|---|
| PubChem CID | 59894554 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (6S)-6-(3,4-dimethoxyphenyl)-8-methyl-6,7,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridine-3,5-dione |
| SMILES | COc1ccc([C@@H]2CC(C)C3COC(=O)N3C2=O)cc1OC |
| InChI | InChI=1S/C16H19NO5/c1-9-6-11(15(18)17-12(9)8-22-16(17)19)10-4-5-13(20-2)14(7-10)21-3/h4-5,7,9,11-12H,6,8H2,1-3H3/t9?,11-,12?/m0/s1 |
| InChIKey | OELOFLBBSLURRE-ZYXZCXLHSA-N |
| XLogP | 2.17 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |