About 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium
2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium (PubChem CID 59894841) has the molecular formula C6H11N2Rf-
and a molecular weight of 378.17 g/mol. Its IUPAC name is 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium.
Molecular Properties
| Compound Name | 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium |
| PubChem CID | 59894841 |
| Molecular Formula | C6H11N2Rf- |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium |
| SMILES | CC1=NCC(C)C[N-]1.[Rf] |
| InChI | InChI=1S/C6H11N2.Rf/c1-5-3-7-6(2)8-4-5;/h5H,3-4H2,1-2H3;/q-1; |
| InChIKey | MSSCORKEQQPNQT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium?
The IUPAC name of 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium (CID 59894841) is 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium.
What is the SMILES notation for 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium?
The canonical SMILES for 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium is CC1=NCC(C)C[N-]1.[Rf].
What is the InChIKey of 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium?
The InChIKey is MSSCORKEQQPNQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2.Rf/c1-5-3-7-6(2)8-4-5;/h5H,3-4H2,1-2H3;/q-1;.
What are the key properties of 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium?
2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium has a molecular weight of 378.17 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-5,6-dihydro-4H-pyrimidin-3-ide;rutherfordium is sourced from PubChem (CID 59894841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).