About 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium
4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium (PubChem CID 59894851) has the molecular formula C6H10NRf-
and a molecular weight of 363.15 g/mol. Its IUPAC name is 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium.
Molecular Properties
| Compound Name | 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium |
| PubChem CID | 59894851 |
| Molecular Formula | C6H10NRf- |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium |
| SMILES | C=C1CC(C)C[N-]1.[Rf] |
| InChI | InChI=1S/C6H10N.Rf/c1-5-3-6(2)7-4-5;/h5H,2-4H2,1H3;/q-1; |
| InChIKey | MQTFLMJDHPNJJW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium?
The IUPAC name of 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium (CID 59894851) is 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium.
What is the SMILES notation for 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium?
The canonical SMILES for 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium is C=C1CC(C)C[N-]1.[Rf].
What is the InChIKey of 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium?
The InChIKey is MQTFLMJDHPNJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N.Rf/c1-5-3-6(2)7-4-5;/h5H,2-4H2,1H3;/q-1;.
What are the key properties of 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium?
4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium has a molecular weight of 363.15 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-methylidenepyrrolidin-1-ide;rutherfordium is sourced from PubChem (CID 59894851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).