C22H27N3O2 — CID 59895171
(2S,4R)-N-(4-benzylphenyl)-1-methyl-4-(propanoylamino)pyrrolidine-2-carboxamide (PubChem CID 59895171) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (2S,4R)-N-(4-benzylphenyl)-1-methyl-4-(propanoylamino)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-(4-benzylphenyl)-1-methyl-4-(propanoylamino)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59895171 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (2S,4R)-N-(4-benzylphenyl)-1-methyl-4-(propanoylamino)pyrrolidine-2-carboxamide |
| SMILES | CCC(=O)N[C@@H]1C[C@@H](C(=O)Nc2ccc(Cc3ccccc3)cc2)N(C)C1 |
| InChI | InChI=1S/C22H27N3O2/c1-3-21(26)23-19-14-20(25(2)15-19)22(27)24-18-11-9-17(10-12-18)13-16-7-5-4-6-8-16/h4-12,19-20H,3,13-15H2,1-2H3,(H,23,26)(H,24,27)/t19-,20+/m1/s1 |
| InChIKey | USNFPTVYNVMTGM-UXHICEINSA-N |
| XLogP | 2.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |