C13H19LiO4P- — CID 59895317
lithium;phosphanide;2,3,4-trimethyl-5-oxo-2,3,4,6,7,8-hexahydrochromene-7-carboxylate (PubChem CID 59895317) has the molecular formula C13H19LiO4P- and a molecular weight of 277.21 g/mol. Its IUPAC name is lithium;phosphanide;2,3,4-trimethyl-5-oxo-2,3,4,6,7,8-hexahydrochromene-7-carboxylate.
| Compound Name | lithium;phosphanide;2,3,4-trimethyl-5-oxo-2,3,4,6,7,8-hexahydrochromene-7-carboxylate |
|---|---|
| PubChem CID | 59895317 |
| Molecular Formula | C13H19LiO4P- |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | lithium;phosphanide;2,3,4-trimethyl-5-oxo-2,3,4,6,7,8-hexahydrochromene-7-carboxylate |
| SMILES | CC1OC2=C(C(=O)CC(C(=O)[O-])C2)C(C)C1C.[Li+].[PH2-] |
| InChI | InChI=1S/C13H18O4.Li.H2P/c1-6-7(2)12-10(14)4-9(13(15)16)5-11(12)17-8(6)3;;/h6-9H,4-5H2,1-3H3,(H,15,16);;1H2/q;+1;-1/p-1 |
| InChIKey | IQIARNPFSVVXAN-UHFFFAOYSA-M |
| XLogP | -2.01 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|