C26H18N4O2+2 — CID 59895352
(1S)-15,20-diphenyl-2,16-dioxa-14,19-diaza-15,20-diazoniapentacyclo[8.5.3.21,4.03,8.013,17]icosa-3(8),4,6,10(18),11,13(17),14,19-octaene (PubChem CID 59895352) has the molecular formula C26H18N4O2+2 and a molecular weight of 418.46 g/mol. Its IUPAC name is (1S)-15,20-diphenyl-2,16-dioxa-14,19-diaza-15,20-diazoniapentacyclo[8.5.3.21,4.03,8.013,17]icosa-3(8),4,6,10(18),11,13(17),14,19-octaene.
| Compound Name | (1S)-15,20-diphenyl-2,16-dioxa-14,19-diaza-15,20-diazoniapentacyclo[8.5.3.21,4.03,8.013,17]icosa-3(8),4,6,10(18),11,13(17),14,19-octaene |
|---|---|
| PubChem CID | 59895352 |
| Molecular Formula | C26H18N4O2+2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (1S)-15,20-diphenyl-2,16-dioxa-14,19-diaza-15,20-diazoniapentacyclo[8.5.3.21,4.03,8.013,17]icosa-3(8),4,6,10(18),11,13(17),14,19-octaene |
| SMILES | c1ccc([N+]2=Nc3ccc4cc3O[C@]23Oc2c(cccc2N=[N+]3c2ccccc2)C4)cc1 |
| InChI | InChI=1S/C26H18N4O2/c1-3-9-20(10-4-1)29-26-30(21-11-5-2-6-12-21)28-23-13-7-8-19(25(23)32-26)16-18-14-15-22(27-29)24(17-18)31-26/h1-15,17H,16H2/q+2/t26-/m0/s1 |
| InChIKey | DQNGSNMWMFZSHD-SANMLTNESA-N |
| XLogP | 6.54 |
| TPSA | 49.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|