C17H30O5 — CID 59895546
(3S,9R,10S,11R,12R)-12-ethyl-4,10-dihydroxy-3,5,9,11-tetramethyl-oxacyclododecane-2,8-dione (PubChem CID 59895546) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is (3S,9R,10S,11R,12R)-12-ethyl-4,10-dihydroxy-3,5,9,11-tetramethyl-oxacyclododecane-2,8-dione.
| Compound Name | (3S,9R,10S,11R,12R)-12-ethyl-4,10-dihydroxy-3,5,9,11-tetramethyl-oxacyclododecane-2,8-dione |
|---|---|
| PubChem CID | 59895546 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (3S,9R,10S,11R,12R)-12-ethyl-4,10-dihydroxy-3,5,9,11-tetramethyl-oxacyclododecane-2,8-dione |
| SMILES | CC[C@H]1OC(=O)[C@@H](C)C(O)C(C)CCC(=O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C17H30O5/c1-6-14-11(4)16(20)10(3)13(18)8-7-9(2)15(19)12(5)17(21)22-14/h9-12,14-16,19-20H,6-8H2,1-5H3/t9?,10-,11-,12-,14+,15?,16+/m0/s1 |
| InChIKey | CICQNNMFQREDPP-QTJPFLJXSA-N |
| XLogP | 1.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |