C13H21NO — CID 59895559
(2R)-2-[(7aS)-4-amino-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl]propanal (PubChem CID 59895559) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (2R)-2-[(7aS)-4-amino-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl]propanal.
| Compound Name | (2R)-2-[(7aS)-4-amino-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl]propanal |
|---|---|
| PubChem CID | 59895559 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2R)-2-[(7aS)-4-amino-7a-methyl-3,3a,4,5,6,7-hexahydroinden-1-yl]propanal |
| SMILES | C[C@@H](C=O)C1=CCC2C(N)CCC[C@]12C |
| InChI | InChI=1S/C13H21NO/c1-9(8-15)10-5-6-11-12(14)4-3-7-13(10,11)2/h5,8-9,11-12H,3-4,6-7,14H2,1-2H3/t9-,11?,12?,13+/m0/s1 |
| InChIKey | ZCTJXBDGGYFYCP-ZHYKRGJUSA-N |
| XLogP | 2.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|