About 2,5-dimethyl-3-phenylfuran
2,5-dimethyl-3-phenylfuran (PubChem CID 598957) has the molecular formula C12H12O
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2,5-dimethyl-3-phenylfuran.
Molecular Properties
| Compound Name | 2,5-dimethyl-3-phenylfuran |
| PubChem CID | 598957 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 2,5-dimethyl-3-phenylfuran |
| SMILES | Cc1cc(-c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C12H12O/c1-9-8-12(10(2)13-9)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | CHNFGGXXEVUWFL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethyl-3-phenylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3-phenylfuran?
The IUPAC name of 2,5-dimethyl-3-phenylfuran (CID 598957) is 2,5-dimethyl-3-phenylfuran.
What is the SMILES notation for 2,5-dimethyl-3-phenylfuran?
The canonical SMILES for 2,5-dimethyl-3-phenylfuran is Cc1cc(-c2ccccc2)c(C)o1.
What is the InChIKey of 2,5-dimethyl-3-phenylfuran?
The InChIKey is CHNFGGXXEVUWFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O/c1-9-8-12(10(2)13-9)11-6-4-3-5-7-11/h3-8H,1-2H3.
What are the key properties of 2,5-dimethyl-3-phenylfuran?
2,5-dimethyl-3-phenylfuran has a molecular weight of 172.23 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3-phenylfuran is sourced from PubChem (CID 598957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).