About CID 59895721
CID 59895721 (PubChem CID 59895721) has the molecular formula C12H22N2O5SiV
and a molecular weight of 355.36 g/mol.
Molecular Properties
| Compound Name | CID 59895721 |
| PubChem CID | 59895721 |
| Molecular Formula | C12H22N2O5SiV |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | — |
| SMILES | [3H]C1CC(OCC(=O)NCCCC[Si]OC)C(CON=[V])O1 |
| InChI | InChI=1S/C12H22N2O5Si.V/c1-16-20-7-3-2-5-14-12(15)9-18-10-4-6-17-11(10)8-19-13;/h10-11H,2-9H2,1H3,(H,14,15);/i6T; |
| InChIKey | PXGOGZYGQSOXNN-IZNLTOPRSA-N |
| XLogP | 0.40 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 59895721 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59895721?
The IUPAC name of CID 59895721 (CID 59895721) is not available.
What is the SMILES notation for CID 59895721?
The canonical SMILES for CID 59895721 is [3H]C1CC(OCC(=O)NCCCC[Si]OC)C(CON=[V])O1.
What is the InChIKey of CID 59895721?
The InChIKey is PXGOGZYGQSOXNN-IZNLTOPRSA-N. The full InChI is InChI=1S/C12H22N2O5Si.V/c1-16-20-7-3-2-5-14-12(15)9-18-10-4-6-17-11(10)8-19-13;/h10-11H,2-9H2,1H3,(H,14,15);/i6T;.
What are the key properties of CID 59895721?
CID 59895721 has a molecular weight of 355.36 g/mol, XLogP of 0.40, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59895721 is sourced from PubChem (CID 59895721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).