About CID 59895910
CID 59895910 (PubChem CID 59895910) has the molecular formula C5H7N3
and a molecular weight of 109.13 g/mol.
Molecular Properties
| Compound Name | CID 59895910 |
| PubChem CID | 59895910 |
| Molecular Formula | C5H7N3 |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.06 |
| IUPAC Name | — |
| SMILES | [CH]c1nnc(C)n1C |
| InChI | InChI=1S/C5H7N3/c1-4-6-7-5(2)8(4)3/h1H,2-3H3 |
| InChIKey | DIKXHLHSIPCYHU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 59895910 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59895910?
The IUPAC name of CID 59895910 (CID 59895910) is not available.
What is the SMILES notation for CID 59895910?
The canonical SMILES for CID 59895910 is [CH]c1nnc(C)n1C.
What is the InChIKey of CID 59895910?
The InChIKey is DIKXHLHSIPCYHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3/c1-4-6-7-5(2)8(4)3/h1H,2-3H3.
What are the key properties of CID 59895910?
CID 59895910 has a molecular weight of 109.13 g/mol, XLogP of 0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59895910 is sourced from PubChem (CID 59895910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).