About (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine
(2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine (PubChem CID 59895925) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine.
Molecular Properties
| Compound Name | (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine |
| PubChem CID | 59895925 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine |
| SMILES | COC[C@H]1CC[C@H](COC)N1C |
| InChI | InChI=1S/C9H19NO2/c1-10-8(6-11-2)4-5-9(10)7-12-3/h8-9H,4-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | YLRPSDKGBXKELT-RKDXNWHRSA-N |
| XLogP | 0.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine?
The IUPAC name of (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine (CID 59895925) is (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine.
What is the SMILES notation for (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine?
The canonical SMILES for (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine is COC[C@H]1CC[C@H](COC)N1C.
What is the InChIKey of (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine?
The InChIKey is YLRPSDKGBXKELT-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H19NO2/c1-10-8(6-11-2)4-5-9(10)7-12-3/h8-9H,4-7H2,1-3H3/t8-,9-/m1/s1.
What are the key properties of (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine?
(2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine has a molecular weight of 173.26 g/mol, XLogP of 0.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2,5-bis(methoxymethyl)-1-methylpyrrolidine is sourced from PubChem (CID 59895925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).