About [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate
[(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate (PubChem CID 59896119) has the molecular formula C18H21NO7
and a molecular weight of 363.37 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate.
Molecular Properties
| Compound Name | [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate |
| PubChem CID | 59896119 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@@H]1COC(c2cccc(OC(C)=O)c2C)=N1 |
| InChI | InChI=1S/C18H21NO7/c1-10-14(6-5-7-16(10)25-12(3)21)18-19-15(8-24-18)17(26-13(4)22)9-23-11(2)20/h5-7,15,17H,8-9H2,1-4H3/t15-,17-/m0/s1 |
| InChIKey | BSMIINMKRBKKPV-RDJZCZTQSA-N |
| XLogP | 1.56 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate?
The IUPAC name of [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate (CID 59896119) is [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate.
What is the SMILES notation for [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate?
The canonical SMILES for [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate is CC(=O)OC[C@H](OC(C)=O)[C@@H]1COC(c2cccc(OC(C)=O)c2C)=N1.
What is the InChIKey of [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate?
The InChIKey is BSMIINMKRBKKPV-RDJZCZTQSA-N. The full InChI is InChI=1S/C18H21NO7/c1-10-14(6-5-7-16(10)25-12(3)21)18-19-15(8-24-18)17(26-13(4)22)9-23-11(2)20/h5-7,15,17H,8-9H2,1-4H3/t15-,17-/m0/s1.
What are the key properties of [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate?
[(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate has a molecular weight of 363.37 g/mol, XLogP of 1.56, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-acetyloxy-2-[(4S)-2-(3-acetyloxy-2-methylphenyl)-4,5-dihydro-1,3-oxazol-4-yl]ethyl] acetate is sourced from PubChem (CID 59896119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).