C28H46O — CID 59896394
(2S,5S,6R,8S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]pentacyclo[9.7.0.02,8.06,8.012,16]octadec-1(11)-en-5-ol (PubChem CID 59896394) has the molecular formula C28H46O and a molecular weight of 398.68 g/mol. Its IUPAC name is (2S,5S,6R,8S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]pentacyclo[9.7.0.02,8.06,8.012,16]octadec-1(11)-en-5-ol.
| Compound Name | (2S,5S,6R,8S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]pentacyclo[9.7.0.02,8.06,8.012,16]octadec-1(11)-en-5-ol |
|---|---|
| PubChem CID | 59896394 |
| Molecular Formula | C28H46O |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.35 |
| IUPAC Name | (2S,5S,6R,8S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]pentacyclo[9.7.0.02,8.06,8.012,16]octadec-1(11)-en-5-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)[C@@H]2C[C@@]21CC3 |
| InChI | InChI=1S/C28H46O/c1-18(2)7-6-8-19(3)21-9-10-22-20-11-16-28-17-24(28)25(29)13-15-27(28,5)23(20)12-14-26(21,22)4/h18-19,21-22,24-25,29H,6-17H2,1-5H3/t19-,21-,22?,24+,25+,26-,27-,28+/m1/s1 |
| InChIKey | LEJUUCUMQIXWKI-SALQRPIVSA-N |
| XLogP | 7.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|