About methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium
methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium (PubChem CID 59896432) has the molecular formula C12H14NO3U-
and a molecular weight of 458.28 g/mol. Its IUPAC name is methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium.
Molecular Properties
| Compound Name | methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium |
| PubChem CID | 59896432 |
| Molecular Formula | C12H14NO3U- |
| Molecular Weight | 458.28 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium |
| SMILES | [CH2-]c1ccccc1/C(=N\OCC)C(=O)OC.[U] |
| InChI | InChI=1S/C12H14NO3.U/c1-4-16-13-11(12(14)15-3)10-8-6-5-7-9(10)2;/h5-8H,2,4H2,1,3H3;/q-1;/b13-11+; |
| InChIKey | YKAQAPFWQITUEE-BNSHTTSQSA-N |
| XLogP | 1.78 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium?
The IUPAC name of methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium (CID 59896432) is methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium.
What is the SMILES notation for methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium?
The canonical SMILES for methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium is [CH2-]c1ccccc1/C(=N\OCC)C(=O)OC.[U].
What is the InChIKey of methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium?
The InChIKey is YKAQAPFWQITUEE-BNSHTTSQSA-N. The full InChI is InChI=1S/C12H14NO3.U/c1-4-16-13-11(12(14)15-3)10-8-6-5-7-9(10)2;/h5-8H,2,4H2,1,3H3;/q-1;/b13-11+;.
What are the key properties of methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium?
methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium has a molecular weight of 458.28 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-2-ethoxyimino-2-(2-methanidylphenyl)acetate;uranium is sourced from PubChem (CID 59896432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).