C28H21N3O7 — CID 59896530
[(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 3-methyl-5-nitrobenzoate (PubChem CID 59896530) has the molecular formula C28H21N3O7 and a molecular weight of 511.49 g/mol. Its IUPAC name is [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 3-methyl-5-nitrobenzoate.
| Compound Name | [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 3-methyl-5-nitrobenzoate |
|---|---|
| PubChem CID | 59896530 |
| Molecular Formula | C28H21N3O7 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | [(19S)-19-ethyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-19-yl] 3-methyl-5-nitrobenzoate |
| SMILES | CC[C@@]1(OC(=O)c2cc(C)cc([N+](=O)[O-])c2)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C28H21N3O7/c1-3-28(38-26(33)17-8-15(2)9-19(11-17)31(35)36)21-12-23-24-18(10-16-6-4-5-7-22(16)29-24)13-30(23)25(32)20(21)14-37-27(28)34/h4-12H,3,13-14H2,1-2H3/t28-/m0/s1 |
| InChIKey | ZYLYOIYIYXDJKK-NDEPHWFRSA-N |
| XLogP | 4.16 |
| TPSA | 130.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|