About [1,2,5]oxadiazolo[3,4-f]cinnoline
[1,2,5]oxadiazolo[3,4-f]cinnoline (PubChem CID 598966) has the molecular formula C8H4N4O
and a molecular weight of 172.15 g/mol. Its IUPAC name is [1,2,5]oxadiazolo[3,4-f]cinnoline.
Molecular Properties
| Compound Name | [1,2,5]oxadiazolo[3,4-f]cinnoline |
| PubChem CID | 598966 |
| Molecular Formula | C8H4N4O |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | [1,2,5]oxadiazolo[3,4-f]cinnoline |
| SMILES | c1cc2c(ccc3nonc32)nn1 |
| InChI | InChI=1S/C8H4N4O/c1-2-7-8(12-13-11-7)5-3-4-9-10-6(1)5/h1-4H |
| InChIKey | ROYWDHJBGXPIPF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1,2,5]oxadiazolo[3,4-f]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,5]oxadiazolo[3,4-f]cinnoline?
The IUPAC name of [1,2,5]oxadiazolo[3,4-f]cinnoline (CID 598966) is [1,2,5]oxadiazolo[3,4-f]cinnoline.
What is the SMILES notation for [1,2,5]oxadiazolo[3,4-f]cinnoline?
The canonical SMILES for [1,2,5]oxadiazolo[3,4-f]cinnoline is c1cc2c(ccc3nonc32)nn1.
What is the InChIKey of [1,2,5]oxadiazolo[3,4-f]cinnoline?
The InChIKey is ROYWDHJBGXPIPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N4O/c1-2-7-8(12-13-11-7)5-3-4-9-10-6(1)5/h1-4H.
What are the key properties of [1,2,5]oxadiazolo[3,4-f]cinnoline?
[1,2,5]oxadiazolo[3,4-f]cinnoline has a molecular weight of 172.15 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,5]oxadiazolo[3,4-f]cinnoline is sourced from PubChem (CID 598966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).