About diethylaminomethanone
diethylaminomethanone (PubChem CID 59896870) has the molecular formula C5H10NO+
and a molecular weight of 100.14 g/mol. Its IUPAC name is diethylaminomethanone.
Molecular Properties
| Compound Name | diethylaminomethanone |
| PubChem CID | 59896870 |
| Molecular Formula | C5H10NO+ |
| Molecular Weight | 100.14 g/mol |
| Exact Mass | 100.08 |
| IUPAC Name | diethylaminomethanone |
| SMILES | CCN([C+]=O)CC |
| InChI | InChI=1S/C5H10NO/c1-3-6(4-2)5-7/h3-4H2,1-2H3/q+1 |
| InChIKey | CFWSJSDRLQOMIH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.14 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze diethylaminomethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylaminomethanone?
The IUPAC name of diethylaminomethanone (CID 59896870) is diethylaminomethanone.
What is the SMILES notation for diethylaminomethanone?
The canonical SMILES for diethylaminomethanone is CCN([C+]=O)CC.
What is the InChIKey of diethylaminomethanone?
The InChIKey is CFWSJSDRLQOMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO/c1-3-6(4-2)5-7/h3-4H2,1-2H3/q+1.
What are the key properties of diethylaminomethanone?
diethylaminomethanone has a molecular weight of 100.14 g/mol, XLogP of 0.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diethylaminomethanone is sourced from PubChem (CID 59896870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).