About CID 59896886
CID 59896886 (PubChem CID 59896886) has the molecular formula C4H5N2O3
and a molecular weight of 129.09 g/mol.
Molecular Properties
| Compound Name | CID 59896886 |
| PubChem CID | 59896886 |
| Molecular Formula | C4H5N2O3 |
| Molecular Weight | 129.09 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | — |
| SMILES | O=C1NC[C](C(=O)O)N1 |
| InChI | InChI=1S/C4H5N2O3/c7-3(8)2-1-5-4(9)6-2/h1H2,(H,7,8)(H2,5,6,9) |
| InChIKey | CBRFAMHBYBMVMF-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.09 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59896886 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59896886?
The IUPAC name of CID 59896886 (CID 59896886) is not available.
What is the SMILES notation for CID 59896886?
The canonical SMILES for CID 59896886 is O=C1NC[C](C(=O)O)N1.
What is the InChIKey of CID 59896886?
The InChIKey is CBRFAMHBYBMVMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N2O3/c7-3(8)2-1-5-4(9)6-2/h1H2,(H,7,8)(H2,5,6,9).
What are the key properties of CID 59896886?
CID 59896886 has a molecular weight of 129.09 g/mol, XLogP of -1.08, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59896886 is sourced from PubChem (CID 59896886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).