About 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone
1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone (PubChem CID 59897662) has the molecular formula C11H12NO2+
and a molecular weight of 190.22 g/mol. Its IUPAC name is 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone |
| PubChem CID | 59897662 |
| Molecular Formula | C11H12NO2+ |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone |
| SMILES | CC(=O)C1=CC=[N+](O)C2C=CC=CC12 |
| InChI | InChI=1S/C11H12NO2/c1-8(13)9-6-7-12(14)11-5-3-2-4-10(9)11/h2-7,10-11,14H,1H3/q+1 |
| InChIKey | WEVAWFIZOTVGGG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone?
The IUPAC name of 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone (CID 59897662) is 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone.
What is the SMILES notation for 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone?
The canonical SMILES for 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone is CC(=O)C1=CC=[N+](O)C2C=CC=CC12.
What is the InChIKey of 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone?
The InChIKey is WEVAWFIZOTVGGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12NO2/c1-8(13)9-6-7-12(14)11-5-3-2-4-10(9)11/h2-7,10-11,14H,1H3/q+1.
What are the key properties of 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone?
1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone has a molecular weight of 190.22 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxy-4a,8a-dihydroquinolin-1-ium-4-yl)ethanone is sourced from PubChem (CID 59897662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).