C20H20F3N3O4S — CID 59897956
[3-[[2-(azidomethyl)-2,3-dihydro-1H-inden-4-yl]oxy]phenyl] 4,4,4-trifluorobutyl sulfite (PubChem CID 59897956) has the molecular formula C20H20F3N3O4S and a molecular weight of 455.46 g/mol. Its IUPAC name is [3-[[2-(azidomethyl)-2,3-dihydro-1H-inden-4-yl]oxy]phenyl] 4,4,4-trifluorobutyl sulfite.
| Compound Name | [3-[[2-(azidomethyl)-2,3-dihydro-1H-inden-4-yl]oxy]phenyl] 4,4,4-trifluorobutyl sulfite |
|---|---|
| PubChem CID | 59897956 |
| Molecular Formula | C20H20F3N3O4S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [3-[[2-(azidomethyl)-2,3-dihydro-1H-inden-4-yl]oxy]phenyl] 4,4,4-trifluorobutyl sulfite |
| SMILES | [N-]=[N+]=NCC1Cc2cccc(Oc3cccc(OS(=O)OCCCC(F)(F)F)c3)c2C1 |
| InChI | InChI=1S/C20H20F3N3O4S/c21-20(22,23)8-3-9-28-31(27)30-17-6-2-5-16(12-17)29-19-7-1-4-15-10-14(11-18(15)19)13-25-26-24/h1-2,4-7,12,14H,3,8-11,13H2 |
| InChIKey | HFRHJJQBFFTBIZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|