About N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide
N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide (PubChem CID 59898084) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide.
Molecular Properties
| Compound Name | N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide |
| PubChem CID | 59898084 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide |
| SMILES | C/C(=C\C(C)(C)N)CCC/N=C(\C)N |
| InChI | InChI=1S/C11H23N3/c1-9(8-11(3,4)13)6-5-7-14-10(2)12/h8H,5-7,13H2,1-4H3,(H2,12,14)/b9-8+ |
| InChIKey | ATTKQRFQEOGPHK-CMDGGOBGSA-N |
| XLogP | 1.83 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide?
The IUPAC name of N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide (CID 59898084) is N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide.
What is the SMILES notation for N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide?
The canonical SMILES for N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide is C/C(=C\C(C)(C)N)CCC/N=C(\C)N.
What is the InChIKey of N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide?
The InChIKey is ATTKQRFQEOGPHK-CMDGGOBGSA-N. The full InChI is InChI=1S/C11H23N3/c1-9(8-11(3,4)13)6-5-7-14-10(2)12/h8H,5-7,13H2,1-4H3,(H2,12,14)/b9-8+.
What are the key properties of N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide?
N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide has a molecular weight of 197.33 g/mol, XLogP of 1.83, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-6-amino-4,6-dimethylhept-4-enyl]ethanimidamide is sourced from PubChem (CID 59898084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).