C18H24O3Y — CID 59898312
4-ethyl-3,4,6,7,8-pentamethyl-1-oxo-4a,8a-dihydronaphthalene-2-carboxylic acid;yttrium (PubChem CID 59898312) has the molecular formula C18H24O3Y and a molecular weight of 377.29 g/mol. Its IUPAC name is 4-ethyl-3,4,6,7,8-pentamethyl-1-oxo-4a,8a-dihydronaphthalene-2-carboxylic acid;yttrium.
| Compound Name | 4-ethyl-3,4,6,7,8-pentamethyl-1-oxo-4a,8a-dihydronaphthalene-2-carboxylic acid;yttrium |
|---|---|
| PubChem CID | 59898312 |
| Molecular Formula | C18H24O3Y |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-ethyl-3,4,6,7,8-pentamethyl-1-oxo-4a,8a-dihydronaphthalene-2-carboxylic acid;yttrium |
| SMILES | CCC1(C)C(C)=C(C(=O)O)C(=O)C2C(C)=C(C)C(C)=CC21.[Y] |
| InChI | InChI=1S/C18H24O3.Y/c1-7-18(6)12(5)15(17(20)21)16(19)14-11(4)10(3)9(2)8-13(14)18;/h8,13-14H,7H2,1-6H3,(H,20,21); |
| InChIKey | AIQYKDZRCHNKGK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|