C17H34N6 — CID 59898335
4-N-butyl-2-N-(methylaminomethyl)-4-N-pentyl-2-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 59898335) has the molecular formula C17H34N6 and a molecular weight of 322.50 g/mol. Its IUPAC name is 4-N-butyl-2-N-(methylaminomethyl)-4-N-pentyl-2-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-butyl-2-N-(methylaminomethyl)-4-N-pentyl-2-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 59898335 |
| Molecular Formula | C17H34N6 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.28 |
| IUPAC Name | 4-N-butyl-2-N-(methylaminomethyl)-4-N-pentyl-2-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCN(CCCC)c1ncnc(N(CCC)CNC)n1 |
| InChI | InChI=1S/C17H34N6/c1-5-8-10-13-22(12-9-6-2)16-19-14-20-17(21-16)23(11-7-3)15-18-4/h14,18H,5-13,15H2,1-4H3 |
| InChIKey | RZFFJFWSRPAZJF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|