C23H18F5NO6 — CID 59898379
ethyl 2-methyl-5-(oxiran-2-ylmethoxy)-1-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethyl]indole-3-carboxylate (PubChem CID 59898379) has the molecular formula C23H18F5NO6 and a molecular weight of 499.39 g/mol. Its IUPAC name is ethyl 2-methyl-5-(oxiran-2-ylmethoxy)-1-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethyl]indole-3-carboxylate.
| Compound Name | ethyl 2-methyl-5-(oxiran-2-ylmethoxy)-1-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 59898379 |
| Molecular Formula | C23H18F5NO6 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | ethyl 2-methyl-5-(oxiran-2-ylmethoxy)-1-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethyl]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(CC(=O)Oc2c(F)c(F)c(F)c(F)c2F)c2ccc(OCC3CO3)cc12 |
| InChI | InChI=1S/C23H18F5NO6/c1-3-32-23(31)16-10(2)29(14-5-4-11(6-13(14)16)33-8-12-9-34-12)7-15(30)35-22-20(27)18(25)17(24)19(26)21(22)28/h4-6,12H,3,7-9H2,1-2H3 |
| InChIKey | ZIBYZCOFVXAFHE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|