About 2-phenylbutyl carbamate
2-phenylbutyl carbamate (PubChem CID 59898507) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-phenylbutyl carbamate.
Molecular Properties
| Compound Name | 2-phenylbutyl carbamate |
| PubChem CID | 59898507 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-phenylbutyl carbamate |
| SMILES | CCC(COC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-9(8-14-11(12)13)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H2,12,13) |
| InChIKey | HEJCTMDGVICQOE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylbutyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylbutyl carbamate?
The IUPAC name of 2-phenylbutyl carbamate (CID 59898507) is 2-phenylbutyl carbamate.
What is the SMILES notation for 2-phenylbutyl carbamate?
The canonical SMILES for 2-phenylbutyl carbamate is CCC(COC(N)=O)c1ccccc1.
What is the InChIKey of 2-phenylbutyl carbamate?
The InChIKey is HEJCTMDGVICQOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-9(8-14-11(12)13)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H2,12,13).
What are the key properties of 2-phenylbutyl carbamate?
2-phenylbutyl carbamate has a molecular weight of 193.25 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylbutyl carbamate is sourced from PubChem (CID 59898507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).