About tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate
tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate (PubChem CID 59898576) has the molecular formula C25H28N2O5
and a molecular weight of 436.51 g/mol. Its IUPAC name is tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate |
| PubChem CID | 59898576 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1-c1ccc2c(c1)OC1(CCOCC1)C(CCC#N)C2=O |
| InChI | InChI=1S/C25H28N2O5/c1-24(2,3)32-23(29)27-13-5-7-20(27)17-8-9-18-21(16-17)31-25(10-14-30-15-11-25)19(22(18)28)6-4-12-26/h5,7-9,13,16,19H,4,6,10-11,14-15H2,1-3H3 |
| InChIKey | HDKLTJGABVSQLN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 90.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate?
The IUPAC name of tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate (CID 59898576) is tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate.
What is the SMILES notation for tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate?
The canonical SMILES for tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate is CC(C)(C)OC(=O)n1cccc1-c1ccc2c(c1)OC1(CCOCC1)C(CCC#N)C2=O.
What is the InChIKey of tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate?
The InChIKey is HDKLTJGABVSQLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2O5/c1-24(2,3)32-23(29)27-13-5-7-20(27)17-8-9-18-21(16-17)31-25(10-14-30-15-11-25)19(22(18)28)6-4-12-26/h5,7-9,13,16,19H,4,6,10-11,14-15H2,1-3H3.
What are the key properties of tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate?
tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate has a molecular weight of 436.51 g/mol, XLogP of 4.98, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[3-(2-cyanoethyl)-4-oxospiro[3H-chromene-2,4'-oxane]-7-yl]pyrrole-1-carboxylate is sourced from PubChem (CID 59898576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).