C42H64O5Si — CID 59899104
methyl 7-[(1R,2R,3R)-3-[tert-butyl-[2-(4-ethylphenyl)ethyl]-phenylsilyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 59899104) has the molecular formula C42H64O5Si and a molecular weight of 677.05 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-[tert-butyl-[2-(4-ethylphenyl)ethyl]-phenylsilyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl-[2-(4-ethylphenyl)ethyl]-phenylsilyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 59899104 |
| Molecular Formula | C42H64O5Si |
| Molecular Weight | 677.05 g/mol |
| Exact Mass | 676.45 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl-[2-(4-ethylphenyl)ethyl]-phenylsilyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCC(C)(O)C/C=C/[C@H]1[C@H](O[Si](CCc2ccc(CC)cc2)(c2ccccc2)C(C)(C)C)CC(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C42H64O5Si/c1-8-10-29-42(6,45)30-18-22-37-36(21-16-11-12-17-23-40(44)46-7)38(43)32-39(37)47-48(41(3,4)5,35-19-14-13-15-20-35)31-28-34-26-24-33(9-2)25-27-34/h13-15,18-20,22,24-27,36-37,39,45H,8-12,16-17,21,23,28-32H2,1-7H3/b22-18+/t36-,37-,39-,42?,48?/m1/s1 |
| InChIKey | LBCUXZHSQASQCE-NYXWBQRDSA-N |
| XLogP | 9.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.05 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|