C47H83NO5Si — CID 59899107
methyl 7-[(1R,2R,3R)-3-[2-[4-[[ethyl(octyl)amino]methyl]phenyl]ethyl-di(propan-2-yl)silyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 59899107) has the molecular formula C47H83NO5Si and a molecular weight of 770.27 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-[2-[4-[[ethyl(octyl)amino]methyl]phenyl]ethyl-di(propan-2-yl)silyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-[2-[4-[[ethyl(octyl)amino]methyl]phenyl]ethyl-di(propan-2-yl)silyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 59899107 |
| Molecular Formula | C47H83NO5Si |
| Molecular Weight | 770.27 g/mol |
| Exact Mass | 769.60 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-[2-[4-[[ethyl(octyl)amino]methyl]phenyl]ethyl-di(propan-2-yl)silyl]oxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCCCCN(CC)Cc1ccc(CC[Si](O[C@@H]2CC(=O)[C@H](CCCCCCC(=O)OC)[C@H]2/C=C/CC(C)(O)CCCC)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C47H83NO5Si/c1-10-13-15-16-19-22-34-48(12-3)37-41-29-27-40(28-30-41)31-35-54(38(4)5,39(6)7)53-45-36-44(49)42(24-20-17-18-21-26-46(50)52-9)43(45)25-23-33-47(8,51)32-14-11-2/h23,25,27-30,38-39,42-43,45,51H,10-22,24,26,31-37H2,1-9H3/b25-23+/t42-,43-,45-,47?/m1/s1 |
| InChIKey | JMTFOHHQCUDTGG-OWGPTHMSSA-N |
| XLogP | 12.17 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.27 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|