C25H42F2O6 — CID 59899364
methyl (Z)-7-[(1R,3R,5S)-2-[2-[2-(1,1-difluoroheptyl)-1,3-dioxolan-2-yl]ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 59899364) has the molecular formula C25H42F2O6 and a molecular weight of 476.60 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,3R,5S)-2-[2-[2-(1,1-difluoroheptyl)-1,3-dioxolan-2-yl]ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,3R,5S)-2-[2-[2-(1,1-difluoroheptyl)-1,3-dioxolan-2-yl]ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59899364 |
| Molecular Formula | C25H42F2O6 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | methyl (Z)-7-[(1R,3R,5S)-2-[2-[2-(1,1-difluoroheptyl)-1,3-dioxolan-2-yl]ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCCCCC(F)(F)C1(CCC2[C@H](O)C[C@H](O)[C@@H]2C/C=C\CCCC(=O)OC)OCCO1 |
| InChI | InChI=1S/C25H42F2O6/c1-3-4-5-10-14-24(26,27)25(32-16-17-33-25)15-13-20-19(21(28)18-22(20)29)11-8-6-7-9-12-23(30)31-2/h6,8,19-22,28-29H,3-5,7,9-18H2,1-2H3/b8-6-/t19-,20?,21+,22-/m1/s1 |
| InChIKey | SJQNOYGQAGDDDH-HJQHKIECSA-N |
| XLogP | 4.76 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|