About 2-phenylpyrimidin-5-ol
2-phenylpyrimidin-5-ol (PubChem CID 598996) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-phenylpyrimidin-5-ol.
Molecular Properties
| Compound Name | 2-phenylpyrimidin-5-ol |
| PubChem CID | 598996 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 2-phenylpyrimidin-5-ol |
| SMILES | Oc1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C10H8N2O/c13-9-6-11-10(12-7-9)8-4-2-1-3-5-8/h1-7,13H |
| InChIKey | VXOJYMHSOARYSV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylpyrimidin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpyrimidin-5-ol?
The IUPAC name of 2-phenylpyrimidin-5-ol (CID 598996) is 2-phenylpyrimidin-5-ol.
What is the SMILES notation for 2-phenylpyrimidin-5-ol?
The canonical SMILES for 2-phenylpyrimidin-5-ol is Oc1cnc(-c2ccccc2)nc1.
What is the InChIKey of 2-phenylpyrimidin-5-ol?
The InChIKey is VXOJYMHSOARYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c13-9-6-11-10(12-7-9)8-4-2-1-3-5-8/h1-7,13H.
What are the key properties of 2-phenylpyrimidin-5-ol?
2-phenylpyrimidin-5-ol has a molecular weight of 172.19 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpyrimidin-5-ol is sourced from PubChem (CID 598996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).