C26H42N2O5Si3 — CID 59899643
(2E)-2-cyano-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-N-[2-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enyl]acetamide (PubChem CID 59899643) has the molecular formula C26H42N2O5Si3 and a molecular weight of 546.89 g/mol. Its IUPAC name is (2E)-2-cyano-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-N-[2-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enyl]acetamide.
| Compound Name | (2E)-2-cyano-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-N-[2-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 59899643 |
| Molecular Formula | C26H42N2O5Si3 |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | (2E)-2-cyano-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-N-[2-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enyl]acetamide |
| SMILES | C=C(CNC(=O)/C(C#N)=C1\CC(C)(C)c2cc(OC)c(OC)cc21)[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C26H42N2O5Si3/c1-18(36(12,32-34(6,7)8)33-35(9,10)11)17-28-25(29)21(16-27)20-15-26(2,3)22-14-24(31-5)23(30-4)13-19(20)22/h13-14H,1,15,17H2,2-12H3,(H,28,29)/b21-20+ |
| InChIKey | KWWZTQSEIXEBSP-QZQOTICOSA-N |
| XLogP | 5.65 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|